CAS 1095-03-0 appears in our catalog under these names: Triphenyl borate, 97%, Triphenyl Borate, Triphenyl borate, 97% , Triphenyl Borate, >96.0%(T), TRIPHENYL BORATE, >=97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g, 100g, 500g, 10G.
Triphenyl borate (CAS 1095-03-0) is a chemical compound with the molecular formula C18H15BO3 and a molecular weight of 290.1 g/mol. IUPAC name: triphenyl borate. InChIKey: MDCWDBMBZLORER-UHFFFAOYSA-N.
| Molecular formula | C18H15BO3 |
|---|---|
| Molecular weight | 290.1 g/mol |
| IUPAC name | triphenyl borate |
| InChIKey | MDCWDBMBZLORER-UHFFFAOYSA-N |
| SMILES | B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)