cas: 437-13-8 — see every product listed under this CAS number, including other names
Triphenylsulfonium Tetrafluoroborate, >98.0%(HPLC) (CAS 437-13-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1608-1G |
| cas | 437-13-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 823.00 Pln | |
| TCI | 5g | 2465.36 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
Triphenylsulfanium tetrafluoroborate (CAS 437-13-8) is a chemical compound with the molecular formula C18H15BF4S and a molecular weight of 350.2 g/mol. IUPAC name: triphenylsulfanium tetrafluoroborate. InChIKey: RTWMEMGVYYTCOZ-UHFFFAOYSA-N.
| Molecular formula | C18H15BF4S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | triphenylsulfanium tetrafluoroborate |
| InChIKey | RTWMEMGVYYTCOZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)