CAS 437-13-8 appears in our catalog under these names: Triphenylsulfonium tetrafluoroborate, 95%, Triphenylsulfoniumtetrafluoroborate, 98%, Triphenylsulfonium Tetrafluoroborate, Triphenylsulfonium Tetrafluoroborate, >98.0%(HPLC), Triphenylsulfonium tetrafluoroborate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 200mg.
Triphenylsulfanium tetrafluoroborate (CAS 437-13-8) is a chemical compound with the molecular formula C18H15BF4S and a molecular weight of 350.2 g/mol. IUPAC name: triphenylsulfanium tetrafluoroborate. InChIKey: RTWMEMGVYYTCOZ-UHFFFAOYSA-N.
| Molecular formula | C18H15BF4S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | triphenylsulfanium tetrafluoroborate |
| InChIKey | RTWMEMGVYYTCOZ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)