CAS 18666-68-7 appears in our catalog under these names: Triphenylvinylsilane/ 98%, Triphenylvinylsilane, Triphenylvinylsilane, >93.0%(GC), Triphenylvinylsilane 95%, Triphenylvinylsilane, 95%, 95%. Offered by: Chemat, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 10g, 2g, 25g, 5g, 1g, 100g.
Ethenyl(triphenyl)silane (CAS 18666-68-7) is a chemical compound with the molecular formula C20H18Si and a molecular weight of 286.4 g/mol. IUPAC name: ethenyl(triphenyl)silane. InChIKey: OVOIHGSHJGMSMZ-UHFFFAOYSA-N.
| Molecular formula | C20H18Si |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | ethenyl(triphenyl)silane |
| InChIKey | OVOIHGSHJGMSMZ-UHFFFAOYSA-N |
| SMILES | C=C[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)