Products 113658-85-8
CAS 113658-85-8 appears in our catalog under these names: Trombodipine/ 99.63% (existing batch purity), Trombodipine (PCA–4230), Trombodipine. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
3-O-ethyl 5-O-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 113658-85-8) is a chemical compound with the molecular formula C21H24N2O7S and a molecular weight of 448.5 g/mol. IUPAC name: 3-O-ethyl 5-O-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: MCNAAGLIGWJLQX-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O7S |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | 3-O-ethyl 5-O-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl] 2,4,6-trimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | MCNAAGLIGWJLQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C)C(=O)OCCN2C(=O)C3=CC=CC=C3S2(=O)=O)C)C |
Computed by PubChem (NCBI)