CAS 2773345-90-5 appears in our catalog under these names: Tubulin polymerization–IN–43, Tubulin polymerization-IN-43, 98%, Tubulin polymerization-IN-43/ 99.85% (existing batch purity), Tubulin polymerization-IN-43 98%, Tubulin polymerization-IN-43, 99.60%. Offered by: GLPBio, AmBeed, TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 100 mg.
6-fluoro-N-(4-methoxyphenyl)-N-methyl-2-(trifluoromethyl)quinazolin-4-amine (CAS 2773345-90-5) is a chemical compound with the molecular formula C17H13F4N3O and a molecular weight of 351.30 g/mol. IUPAC name: 6-fluoro-N-(4-methoxyphenyl)-N-methyl-2-(trifluoromethyl)quinazolin-4-amine. InChIKey: YTTBMLZFUZWEBE-UHFFFAOYSA-N.
| Molecular formula | C17H13F4N3O |
|---|---|
| Molecular weight | 351.30 g/mol |
| IUPAC name | 6-fluoro-N-(4-methoxyphenyl)-N-methyl-2-(trifluoromethyl)quinazolin-4-amine |
| InChIKey | YTTBMLZFUZWEBE-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)OC)C2=NC(=NC3=C2C=C(C=C3)F)C(F)(F)F |
Computed by PubChem (NCBI)