CAS 948304-40-3 appears in our catalog under these names: t-TUCB, min. 95 %, 25 mg, UC-1728, 99+%, UC-1728/ 99.88% (existing batch purity), t-TUCB, UC-1728 95%. Offered by: Roth, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 25mg, 250mg, 2mg, 5mg, 10mg, 50mg, 100mg, 500mg.
4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexyl]oxybenzoic acid (CAS 948304-40-3) is a chemical compound with the molecular formula C21H21F3N2O5 and a molecular weight of 438.4 g/mol. IUPAC name: 4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexyl]oxybenzoic acid. InChIKey: XDVFKCZZXOGEMN-UHFFFAOYSA-N.
| Molecular formula | C21H21F3N2O5 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | 4-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexyl]oxybenzoic acid |
| InChIKey | XDVFKCZZXOGEMN-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)