CAS 1450666-80-4 appears in our catalog under these names: UCT943/ 99.18% (existing batch purity), UCT943, UCT943 , UCT943, 99.08%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
[4-[5-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone (CAS 1450666-80-4) is a chemical compound with the molecular formula C22H20F3N5O and a molecular weight of 427.4 g/mol. IUPAC name: [4-[5-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone. InChIKey: GGOFGCMPKAWHEZ-UHFFFAOYSA-N.
| Molecular formula | C22H20F3N5O |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [4-[5-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone |
| InChIKey | GGOFGCMPKAWHEZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)C3=CN=C(C(=N3)C4=CC=C(C=C4)C(F)(F)F)N |
Computed by PubChem (NCBI)