CAS 2497409-01-3 appears in our catalog under these names: ULK1-IN-2/ 99.76% (existing batch purity), ULK1–IN–2, ULK1-IN-2 98%, 5-Bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)-2-pyrimidinamine, 98%, 98%, ULK1-IN-2, 98.34%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
5-bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (CAS 2497409-01-3) is a chemical compound with the molecular formula C19H16BrFN4O6 and a molecular weight of 495.3 g/mol. IUPAC name: 5-bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine. InChIKey: CVOMZGNACQPPDA-UHFFFAOYSA-N.
| Molecular formula | C19H16BrFN4O6 |
|---|---|
| Molecular weight | 495.3 g/mol |
| IUPAC name | 5-bromo-4-(2-fluoro-4-nitrophenoxy)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| InChIKey | CVOMZGNACQPPDA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)NC2=NC=C(C(=N2)OC3=C(C=C(C=C3)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)