CAS 1350547-65-7 appears in our catalog under these names: UNC 569, UNC569/ 99.31% (existing batch purity), UNC569, UNC569 99%, Mer RTK Inhibitor, UNC569 1PC X 10MG. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-[(4-aminocyclohexyl)methyl]-N-butyl-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-6-amine (CAS 1350547-65-7) is a chemical compound with the molecular formula C22H29FN6 and a molecular weight of 396.5 g/mol. IUPAC name: 1-[(4-aminocyclohexyl)methyl]-N-butyl-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-6-amine. InChIKey: OGEBRHQLRGFBNV-UHFFFAOYSA-N.
| Molecular formula | C22H29FN6 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 1-[(4-aminocyclohexyl)methyl]-N-butyl-3-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| InChIKey | OGEBRHQLRGFBNV-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC=C2C(=NN(C2=N1)CC3CCC(CC3)N)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)