CAS 755753-89-0 appears in our catalog under these names: Org 48762–0, Org 48762-0, 99.99%, UR13870/ 98.92% (existing batch purity), 4,6-Bis(4-fluorophenyl)-2-methyl-5-(4-pyridinyl)-2H-pyrazolo[3,4-b]pyridine. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 50mg, 25 mg, 1 mg, 50 mg, 5 mg, 10 mg, 100 mg.
4,6-bis(4-fluorophenyl)-2-methyl-5-pyridin-4-ylpyrazolo[3,4-b]pyridine (CAS 755753-89-0) is a chemical compound with the molecular formula C24H16F2N4 and a molecular weight of 398.4 g/mol. IUPAC name: 4,6-bis(4-fluorophenyl)-2-methyl-5-pyridin-4-ylpyrazolo[3,4-b]pyridine. InChIKey: VMAKTIDYMSNPOV-UHFFFAOYSA-N.
| Molecular formula | C24H16F2N4 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 4,6-bis(4-fluorophenyl)-2-methyl-5-pyridin-4-ylpyrazolo[3,4-b]pyridine |
| InChIKey | VMAKTIDYMSNPOV-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=C(C(=NC2=N1)C3=CC=C(C=C3)F)C4=CC=NC=C4)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)