CAS 2931509-14-5 appears in our catalog under these names: USP28–IN–3, USP28-IN-3/ 99.85% (existing batch purity), USP28-IN-3, USP28-IN-3, 98.26%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
2-chloro-N-[4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-methylsulfonylbenzamide (CAS 2931509-14-5) is a chemical compound with the molecular formula C23H20Cl2N2O3S and a molecular weight of 475.4 g/mol. IUPAC name: 2-chloro-N-[4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-methylsulfonylbenzamide. InChIKey: CSUMERAOZKVEGF-UHFFFAOYSA-N.
| Molecular formula | C23H20Cl2N2O3S |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | 2-chloro-N-[4-chloro-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)phenyl]-4-methylsulfonylbenzamide |
| InChIKey | CSUMERAOZKVEGF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)NC2=CC(=C(C=C2)Cl)C3=CC4=C(CNCC4)C=C3)Cl |
Computed by PubChem (NCBI)