CAS 1247825-37-1 appears in our catalog under these names: Usp7-usp47 inhibitor, 95%, USP7/USP47 inhibitor/ 98.5% (existing batch purity), USP7/USP47 inhibitor, USP7/USP47 inhibitor, USP7-USP47 inhibitor, 98.71% ,, 98.71% ,. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
4-cyano-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)thiophene-2-carboxamide (CAS 1247825-37-1) is a chemical compound with the molecular formula C18H11Cl2N3O3S3 and a molecular weight of 484.4 g/mol. IUPAC name: 4-cyano-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)thiophene-2-carboxamide. InChIKey: GUDJFFQZIISQJB-UHFFFAOYSA-N.
| Molecular formula | C18H11Cl2N3O3S3 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | 4-cyano-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-methylsulfonylphenyl)thiophene-2-carboxamide |
| InChIKey | GUDJFFQZIISQJB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)NC(=O)C2=CC(=C(S2)SC3=C(C=NC=C3Cl)Cl)C#N |
Computed by PubChem (NCBI)