Products 2477650-96-5
CAS 2477650-96-5 appears in our catalog under these names: USP8–IN–1, USP8-IN-1/ 98.01% (existing batch purity), USP8-IN-1, USP8-IN-1, 99.07%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 25 mg.
4-(2-amino-4-methoxyphenyl)-N-(4-nitrophenyl)piperazine-1-carbothioamide (CAS 2477650-96-5) is a chemical compound with the molecular formula C18H21N5O3S and a molecular weight of 387.5 g/mol. IUPAC name: 4-(2-amino-4-methoxyphenyl)-N-(4-nitrophenyl)piperazine-1-carbothioamide. InChIKey: LYQOAIJZQPUZEF-UHFFFAOYSA-N.
| Molecular formula | C18H21N5O3S |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 4-(2-amino-4-methoxyphenyl)-N-(4-nitrophenyl)piperazine-1-carbothioamide |
| InChIKey | LYQOAIJZQPUZEF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2CCN(CC2)C(=S)NC3=CC=C(C=C3)[N+](=O)[O-])N |
Computed by PubChem (NCBI)