CAS 2477651-11-7 appears in our catalog under these names: USP8-IN-2/ 98.83% (existing batch purity), USP8–IN–2, USP8-IN-2, USP8-IN-2, 99.91%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
1-(5-chloro-2-methoxyphenyl)-3-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiourea (CAS 2477651-11-7) is a chemical compound with the molecular formula C19H20ClF3N4OS and a molecular weight of 444.9 g/mol. IUPAC name: 1-(5-chloro-2-methoxyphenyl)-3-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiourea. InChIKey: XKLBIJSKEVHKCM-UHFFFAOYSA-N.
| Molecular formula | C19H20ClF3N4OS |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | 1-(5-chloro-2-methoxyphenyl)-3-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]thiourea |
| InChIKey | XKLBIJSKEVHKCM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=S)NC2CCN(CC2)C3=CC=CC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)