CAS 1425485-87-5 appears in our catalog under these names: Uplarafenib, 98+%, Uplarafenib/ 99.85% (existing batch purity), B–Raf IN 10, Uplarafenib 98+%, Uplarafenib. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
N-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide (CAS 1425485-87-5) is a chemical compound with the molecular formula C22H21F3N4O4S and a molecular weight of 494.5 g/mol. IUPAC name: N-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide. InChIKey: HAYBWDINAFTFCJ-UHFFFAOYSA-N.
| Molecular formula | C22H21F3N4O4S |
|---|---|
| Molecular weight | 494.5 g/mol |
| IUPAC name | N-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide |
| InChIKey | HAYBWDINAFTFCJ-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=CC(=C(C(=C1F)C(=O)C2=CC3=NC(=CN=C3C=C2)N4CCOCC4)F)F |
Computed by PubChem (NCBI)