CAS 1047634-65-0 appears in our catalog under these names: GSK2141795, Uprosertib/ 99.54% (existing batch purity), Uprosertib, Uprosertib 99%, Uprosertib, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 200mg, 5mg, 50mg, 1mg, 2mg.
N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)furan-2-carboxamide (CAS 1047634-65-0) is a chemical compound with the molecular formula C18H16Cl2F2N4O2 and a molecular weight of 429.2 g/mol. IUPAC name: N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)furan-2-carboxamide. InChIKey: AXTAPYRUEKNRBA-JTQLQIEISA-N.
| Molecular formula | C18H16Cl2F2N4O2 |
|---|---|
| Molecular weight | 429.2 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-1-methylpyrazol-5-yl)furan-2-carboxamide |
| InChIKey | AXTAPYRUEKNRBA-JTQLQIEISA-N |
| SMILES | CN1C(=C(C=N1)Cl)C2=C(OC(=C2)C(=O)N[C@@H](CC3=CC(=C(C=C3)F)F)CN)Cl |
Computed by PubChem (NCBI)