Products 91627-33-7
CAS 91627-33-7 appears in our catalog under these names: Uricosuric agent-1/ 100%, 2-(4-(2-Ethylbenzofuran-3-carbonyl)phenoxy)acetic acid, Uricosuric agent-1. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-[4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]acetic acid (CAS 91627-33-7) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 324.3 g/mol. IUPAC name: 2-[4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]acetic acid. InChIKey: XSDFWTIKVXKOGJ-UHFFFAOYSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-[4-(2-ethyl-1-benzofuran-3-carbonyl)phenoxy]acetic acid |
| InChIKey | XSDFWTIKVXKOGJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC=C(C=C3)OCC(=O)O |
Computed by PubChem (NCBI)