Uridine 5′-(trihydrogen diphosphate), P′-[2-(acetylamino)-2-deoxy-α-D-glucopyranosyl] ester, sodium salt (1:2), 98%
cas: 91183-98-1 — see every product listed under this CAS number, including other names
Uridine 5′-(trihydrogen diphosphate), P′-[2-(acetylamino)-2-deoxy-α-D-glucopyranosyl] ester, sodium salt (1:2), 98% (CAS 91183-98-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114VA5-5mg |
| cas | 91183-98-1 |
| size | 5mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 222.80 Pln | |
| Chemat | 10mg | 299.60 Pln | |
| Chemat | 25mg | 414.80 Pln | |
| Chemat | 50mg | 707.60 Pln | |
| Chemat | 100mg | 1024.40 Pln | |
| Chemat | 250mg | 1898.00 Pln | |
| Chemat | 500mg | 3693.20 Pln | |
| Chemat | 1g | 7283.60 Pln | |
| Chemat | 5g | 28946.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Disodium;[[[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphate (CAS 91183-98-1) is a chemical compound with the molecular formula C17H25N3Na2O17P2 and a molecular weight of 651.3 g/mol. IUPAC name: disodium;[[[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphate. InChIKey: QPVVSHDMHSMGCY-CDXPOITNSA-L.
| Molecular formula | C17H25N3Na2O17P2 |
|---|---|
| Molecular weight | 651.3 g/mol |
| IUPAC name | disodium;[[[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-hydroxyphosphoryl] phosphate |
| InChIKey | QPVVSHDMHSMGCY-CDXPOITNSA-L |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1C([C@@H]2[C@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O)OP(=O)(O)OP(=O)([O-])[O-])CO)O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)
