CAS 1855871-76-9 appears in our catalog under these names: V-9302/ 99.52% (existing batch purity), V-9302, V-9302 99%, (S)-2-Amino-4-(bis(2-((3-methylbenzyl)oxy)benzyl)amino)butanoic acid, 99%, 99%, V-9302, 99.46%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg, 10 mg.
(2S)-2-amino-4-[bis[[2-[(3-methylphenyl)methoxy]phenyl]methyl]amino]butanoic acid (CAS 1855871-76-9) is a chemical compound with the molecular formula C34H38N2O4 and a molecular weight of 538.7 g/mol. IUPAC name: (2S)-2-amino-4-[bis[[2-[(3-methylphenyl)methoxy]phenyl]methyl]amino]butanoic acid. InChIKey: YGKNVAAMULVFNN-HKBQPEDESA-N.
| Molecular formula | C34H38N2O4 |
|---|---|
| Molecular weight | 538.7 g/mol |
| IUPAC name | (2S)-2-amino-4-[bis[[2-[(3-methylphenyl)methoxy]phenyl]methyl]amino]butanoic acid |
| InChIKey | YGKNVAAMULVFNN-HKBQPEDESA-N |
| SMILES | CC1=CC(=CC=C1)COC2=CC=CC=C2CN(CC[C@@H](C(=O)O)N)CC3=CC=CC=C3OCC4=CC=CC(=C4)C |
Computed by PubChem (NCBI)