CAS 2230186-18-0 appears in our catalog under these names: VB124/ 99.21% (existing batch purity), VB124, VB124 99%, 2-((1-(2-Chlorophenyl)-5-(3-cyclopropoxyphenyl)-1H-pyrazol-3-yl)methoxy)-2-methylpropanoic acid, 95%, 95%, VB124, 99.86%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
2-[[1-(2-chlorophenyl)-5-(3-cyclopropyloxyphenyl)pyrazol-3-yl]methoxy]-2-methylpropanoic acid (CAS 2230186-18-0) is a chemical compound with the molecular formula C23H23ClN2O4 and a molecular weight of 426.9 g/mol. IUPAC name: 2-[[1-(2-chlorophenyl)-5-(3-cyclopropyloxyphenyl)pyrazol-3-yl]methoxy]-2-methylpropanoic acid. InChIKey: PZHRLEZWTVYGMP-UHFFFAOYSA-N.
| Molecular formula | C23H23ClN2O4 |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | 2-[[1-(2-chlorophenyl)-5-(3-cyclopropyloxyphenyl)pyrazol-3-yl]methoxy]-2-methylpropanoic acid |
| InChIKey | PZHRLEZWTVYGMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OCC1=NN(C(=C1)C2=CC(=CC=C2)OC3CC3)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)