Products 747413-08-7
CAS 747413-08-7 appears in our catalog under these names: VER-50589/ 99.85% (existing batch purity), VER–50589, VER-50589, VER-50589 99%, Ver-50589, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL.
5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide (CAS 747413-08-7) is a chemical compound with the molecular formula C19H17ClN2O5 and a molecular weight of 388.8 g/mol. IUPAC name: 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide. InChIKey: JXPCDMPJCKNLBY-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O5 |
|---|---|
| Molecular weight | 388.8 g/mol |
| IUPAC name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| InChIKey | JXPCDMPJCKNLBY-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=NOC(=C1C2=CC=C(C=C2)OC)C3=CC(=C(C=C3O)O)Cl |
Computed by PubChem (NCBI)