CAS 1204296-79-6 appears in our catalog under these names: VGSCs-IN-1/ 99.5% (existing batch purity), 2-(piperazin-1-yl)-6-(trifluoromethoxy)-1,3-benzothiazole, VGSCs-IN-1. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
2-piperazin-1-yl-6-(trifluoromethoxy)-1,3-benzothiazole (CAS 1204296-79-6) is a chemical compound with the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. IUPAC name: 2-piperazin-1-yl-6-(trifluoromethoxy)-1,3-benzothiazole. InChIKey: IFWQLRCODRPXKE-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3OS |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 2-piperazin-1-yl-6-(trifluoromethoxy)-1,3-benzothiazole |
| InChIKey | IFWQLRCODRPXKE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(S2)C=C(C=C3)OC(F)(F)F |
Computed by PubChem (NCBI)