CAS 1624602-30-7 appears in our catalog under these names: VR23, VR23/ 99.62% (existing batch purity), 7-Chloro-4-(4-((2,4-dinitrophenyl)sulfonyl)-1-piperazinyl)quinoline-d8, VR23 [Proteasome Inhibitor], VR23 99%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, Ambeed. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 200mg, 1mg.
7-chloro-4-[4-(2,4-dinitrophenyl)sulfonylpiperazin-1-yl]quinoline (CAS 1624602-30-7) is a chemical compound with the molecular formula C19H16ClN5O6S and a molecular weight of 477.9 g/mol. IUPAC name: 7-chloro-4-[4-(2,4-dinitrophenyl)sulfonylpiperazin-1-yl]quinoline. InChIKey: PDQVZPPIHADUOO-UHFFFAOYSA-N.
| Molecular formula | C19H16ClN5O6S |
|---|---|
| Molecular weight | 477.9 g/mol |
| IUPAC name | 7-chloro-4-[4-(2,4-dinitrophenyl)sulfonylpiperazin-1-yl]quinoline |
| InChIKey | PDQVZPPIHADUOO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=C3C=CC(=CC3=NC=C2)Cl)S(=O)(=O)C4=C(C=C(C=C4)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)