CAS 2378855-09-3 appears in our catalog under these names: VRK-IN-1/ 99.25% (existing batch purity), VRK–IN–1, Vrk-IN-1, VRK-IN-1 98%, VRK-IN-1, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 50 mg.
4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol (CAS 2378855-09-3) is a chemical compound with the molecular formula C18H11F4NO2 and a molecular weight of 349.3 g/mol. IUPAC name: 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol. InChIKey: PMRGRXLXKYUDIH-UHFFFAOYSA-N.
| Molecular formula | C18H11F4NO2 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 4-[5-(3,5-difluoro-4-hydroxyphenyl)-6-methyl-3-pyridinyl]-2,6-difluorophenol |
| InChIKey | PMRGRXLXKYUDIH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C2=CC(=C(C(=C2)F)O)F)C3=CC(=C(C(=C3)F)O)F |
Computed by PubChem (NCBI)