CAS 1630936-95-6 appears in our catalog under these names: VU 0422288, >95% (HPLC), VU0422288/ 95.48% (existing batch purity), ML–396, VU 0422288, VU 0422288, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 500mg, 5 mg, 100 mg.
N-[3-chloro-4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-2-carboxamide (CAS 1630936-95-6) is a chemical compound with the molecular formula C17H11Cl2N3O2 and a molecular weight of 360.2 g/mol. IUPAC name: N-[3-chloro-4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-2-carboxamide. InChIKey: MZRLPXFGQKQHST-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2N3O2 |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | N-[3-chloro-4-[(5-chloro-2-pyridinyl)oxy]phenyl]pyridine-2-carboxamide |
| InChIKey | MZRLPXFGQKQHST-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=CC(=C(C=C2)OC3=NC=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)