CAS 923417-09-8 appears in our catalog under these names: VU533/ 99.08% (existing batch purity), VU533, VU533 98%, N-(4,7-Dimethylbenzo[d]thiazol-2-yl)-1-((4-fluorophenyl)sulfonyl)piperidine-4-carboxamide, 98%, 98%, VU533, 99.84%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (CAS 923417-09-8) is a chemical compound with the molecular formula C21H22FN3O3S2 and a molecular weight of 447.6 g/mol. IUPAC name: N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide. InChIKey: UKXHDJBIBJBTIU-UHFFFAOYSA-N.
| Molecular formula | C21H22FN3O3S2 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| InChIKey | UKXHDJBIBJBTIU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C)SC(=N2)NC(=O)C3CCN(CC3)S(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)