CAS 923509-20-0 appears in our catalog under these names: VU534/ 99.22% (existing batch purity), VU534, VU534 99%, N-(5,7-Dimethylbenzo[d]thiazol-2-yl)-1-((4-fluorophenyl)sulfonyl)piperidine-4-carboxamide, 99%, 99%, VU534, 98.10%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (CAS 923509-20-0) is a chemical compound with the molecular formula C21H22FN3O3S2 and a molecular weight of 447.6 g/mol. IUPAC name: N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide. InChIKey: RLHUIVPGYWWIQZ-UHFFFAOYSA-N.
| Molecular formula | C21H22FN3O3S2 |
|---|---|
| Molecular weight | 447.6 g/mol |
| IUPAC name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| InChIKey | RLHUIVPGYWWIQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(S2)NC(=O)C3CCN(CC3)S(=O)(=O)C4=CC=C(C=C4)F)C |
Computed by PubChem (NCBI)