Products 19950-55-1
CAS 19950-55-1 appears in our catalog under these names: Veraguensin, Veraguensin, >95% (HPLC), Veraguensin/ 100%, Veraguensin, 99.89%. Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
(2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane (CAS 19950-55-1) is a chemical compound with the molecular formula C22H28O5 and a molecular weight of 372.5 g/mol. IUPAC name: (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane. InChIKey: JLJAVUZBHSLLJL-GKHNXXNSSA-N.
| Molecular formula | C22H28O5 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolane |
| InChIKey | JLJAVUZBHSLLJL-GKHNXXNSSA-N |
| SMILES | C[C@H]1[C@@H]([C@H](O[C@H]1C2=CC(=C(C=C2)OC)OC)C3=CC(=C(C=C3)OC)OC)C |
Computed by PubChem (NCBI)