cas: 60-70-8 — see every product listed under this CAS number, including other names
Veratramine 98% (CAS 60-70-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139966-50mg |
| cas | 60-70-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 314.75 Pln | |
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2250.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A139966 |
Veratramine is a piperidine alkaloid comprising the 14,15,16,17-tetradehydro derivative of veratraman having two hydroxy groups at the 3- and 23-positions. It derives from a hydride of a veratraman.
Source: ChEBI
| Molecular formula | C27H39NO2 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | (2S,3R,5S)-2-[(1S)-1-[(3S,6aR,11aS,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]ethyl]-5-methylpiperidin-3-ol |
| InChIKey | MALFODICFSIXPO-KFKQDBFTSA-N |
| SMILES | C[C@H]1C[C@H]([C@@H](NC1)[C@@H](C)C2=C(C3=C(C=C2)[C@@H]4CC=C5C[C@H](CC[C@@]5([C@H]4C3)C)O)C)O |
Computed by PubChem (NCBI)