cas: 60-70-8 — see every product listed under this CAS number, including other names
Veratramine, 98%, 98% (CAS 60-70-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECEW-5mg |
| cas | 60-70-8 |
| size | 5mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 93.20 Pln | |
| Chemat | 10mg | 112.40 Pln | |
| Chemat | 50mg | 237.20 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1658.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Veratramine is a piperidine alkaloid comprising the 14,15,16,17-tetradehydro derivative of veratraman having two hydroxy groups at the 3- and 23-positions. It derives from a hydride of a veratraman.
Source: ChEBI
| Molecular formula | C27H39NO2 |
|---|---|
| Molecular weight | 409.6 g/mol |
| IUPAC name | (2S,3R,5S)-2-[(1S)-1-[(3S,6aR,11aS,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]ethyl]-5-methylpiperidin-3-ol |
| InChIKey | MALFODICFSIXPO-KFKQDBFTSA-N |
| SMILES | C[C@H]1C[C@H]([C@@H](NC1)[C@@H](C)C2=C(C3=C(C=C2)[C@@H]4CC=C5C[C@H](CC[C@@]5([C@H]4C3)C)O)C)O |
Computed by PubChem (NCBI)