CAS 698394-73-9 appears in our catalog under these names: Vercirnon, 95%, Vercirnon/ 99.15% (existing batch purity), Vercirnon, Vercirnon 98%, Vercirnon, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 10mM (in 1ml dmso).
4-tert-butyl-N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]benzenesulfonamide (CAS 698394-73-9) is a chemical compound with the molecular formula C22H21ClN2O4S and a molecular weight of 444.9 g/mol. IUPAC name: 4-tert-butyl-N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]benzenesulfonamide. InChIKey: JRWROCIMSDXGOZ-UHFFFAOYSA-N.
| Molecular formula | C22H21ClN2O4S |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | 4-tert-butyl-N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]benzenesulfonamide |
| InChIKey | JRWROCIMSDXGOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)Cl)C(=O)C3=CC=[N+](C=C3)[O-] |
Computed by PubChem (NCBI)