CAS 1392136-43-4 appears in our catalog under these names: Verdinexor/ 98.79% (existing batch purity), Verdinexor (KPT–335), Verdinexor 99%, Verdinexor (KPT-335), 99%, 99%, Verdinexor, 99.94%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g.
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide (CAS 1392136-43-4) is a chemical compound with the molecular formula C18H12F6N6O and a molecular weight of 442.3 g/mol. IUPAC name: (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide. InChIKey: OPAKEJZFFCECPN-XQRVVYSFSA-N.
| Molecular formula | C18H12F6N6O |
|---|---|
| Molecular weight | 442.3 g/mol |
| IUPAC name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide |
| InChIKey | OPAKEJZFFCECPN-XQRVVYSFSA-N |
| SMILES | C1=CC=NC(=C1)NNC(=O)/C=C\N2C=NC(=N2)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)