CAS 1286770-55-5 appears in our catalog under these names: Verubecestat (MK–8931), Verubecestat, >95% (HPLC), Verubecestat/ min. 98%, Verubecestat, Verubecestat 98%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 10mM (in 1ml dmso), 50mg, 2mg, 500mg.
N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (CAS 1286770-55-5) is a chemical compound with the molecular formula C17H17F2N5O3S and a molecular weight of 409.4 g/mol. IUPAC name: N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide. InChIKey: YHYKUSGACIYRML-KRWDZBQOSA-N.
| Molecular formula | C17H17F2N5O3S |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| InChIKey | YHYKUSGACIYRML-KRWDZBQOSA-N |
| SMILES | C[C@]1(CS(=O)(=O)N(C(=N1)N)C)C2=C(C=CC(=C2)NC(=O)C3=NC=C(C=C3)F)F |
Computed by PubChem (NCBI)