cas: 917369-31-4 — see every product listed under this CAS number, including other names
Verubulin (hydrochloride), 98.71% (CAS 917369-31-4) is a chemical reagent available from Chemat. Available pack sizes: 25 mg, 10 mg, 100 mg, 50 mg, 10mM/1mL, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-12098-25 mg |
| cas | 917369-31-4 |
| size | 25 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 mg | 1606.08 Pln | |
| MedChemExpress | 10 mg | 886.26 Pln | |
| MedChemExpress | 100 mg | 3477.61 Pln | |
| MedChemExpress | 50 mg | 2423.42 Pln | |
| MedChemExpress | 10mM/1mL | 649.42 Pln | |
| MedChemExpress | 5 mg | 598.33 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.71% |
N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride (CAS 917369-31-4) is a chemical compound with the molecular formula C17H18ClN3O and a molecular weight of 315.8 g/mol. IUPAC name: N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride. InChIKey: VYUWDIKZJLOZJL-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-N,2-dimethylquinazolin-4-amine;hydrochloride |
| InChIKey | VYUWDIKZJLOZJL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=N1)N(C)C3=CC=C(C=C3)OC.Cl |
Computed by PubChem (NCBI)