CAS 120447-62-3 appears in our catalog under these names: rel-Vesamicol Hydrochloride, Vesamicol hydrochloride/ 98.31% (existing batch purity), (±)–Vesamicol hydrochloride, (±)-Vesamicol HCl 99%, rel-(1R,2R)-2-(4-Phenylpiperidin-1-yl)cyclohexan-1-ol hydrochloride, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 500mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg.
2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol;hydrochloride (CAS 120447-62-3) is a chemical compound with the molecular formula C17H26ClNO and a molecular weight of 295.8 g/mol. IUPAC name: 2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol;hydrochloride. InChIKey: XJNUHVMJVWOYCW-UHFFFAOYSA-N.
| Molecular formula | C17H26ClNO |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 2-(4-phenylpiperidin-1-yl)cyclohexan-1-ol;hydrochloride |
| InChIKey | XJNUHVMJVWOYCW-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)N2CCC(CC2)C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)