CAS 1228585-88-3 appears in our catalog under these names: GS–9620, Vesatolimod/ 99.92% (existing batch purity), GS 9620, Vesatolimod 98%, 4-Amino-2-butoxy-7,8-dihydro-8-[[3-(1-pyrrolidinylmethyl)phenyl]methyl]-6(5H)-pteridinone, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 25mg, 100mg, 1mg, 250mg.
4-amino-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one (CAS 1228585-88-3) is a chemical compound with the molecular formula C22H30N6O2 and a molecular weight of 410.5 g/mol. IUPAC name: 4-amino-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one. InChIKey: VFOKSTCIRGDTBR-UHFFFAOYSA-N.
| Molecular formula | C22H30N6O2 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 4-amino-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
| InChIKey | VFOKSTCIRGDTBR-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC(=C2C(=N1)N(CC(=O)N2)CC3=CC=CC(=C3)CN4CCCC4)N |
Computed by PubChem (NCBI)