cas: 881681-01-2 — see every product listed under this CAS number, including other names
Vonoprazan Fumarate 98% (CAS 881681-01-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108580-5mg |
| cas | 881681-01-2 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 120.06 Pln | |
| Ambeed | 10mg | 131.19 Pln | |
| Ambeed | 25mg | 147.88 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2267.19 Pln | |
| Ambeed | 100g | 7112.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108580 |
(E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (CAS 881681-01-2) is a chemical compound with the molecular formula C21H20FN3O6S and a molecular weight of 461.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine. InChIKey: ROGSHYHKHPCCJW-WLHGVMLRSA-N.
| Molecular formula | C21H20FN3O6S |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| InChIKey | ROGSHYHKHPCCJW-WLHGVMLRSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)