CAS 881681-01-2 appears in our catalog under these names: Vonoprazan Fumarate, Vonoprazan Fumarate, >95% (HPLC), Vonoprazan Fumarate, Vonoprazan Fumarate/ min. 98%, Vonoprazan Fumarate 98%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 50mg, 5mg, 250mg, 100mg, 10mM (in 1ml dmso), 500mg.
(E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (CAS 881681-01-2) is a chemical compound with the molecular formula C21H20FN3O6S and a molecular weight of 461.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine. InChIKey: ROGSHYHKHPCCJW-WLHGVMLRSA-N.
| Molecular formula | C21H20FN3O6S |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;1-[5-(2-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| InChIKey | ROGSHYHKHPCCJW-WLHGVMLRSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CN=CC=C3.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)