CAS 669764-18-5 appears in our catalog under these names: WAY–169916, WAY-169916, 97%, WAY-169916/ 98.44% (existing batch purity), WAY-169916, 4-(1-Allyl-7-(trifluoromethyl)-1H-indazol-3-yl)benzene-1,3-diol. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 1g, 10mg, 25mg, 50mg, 2mg, 200mg.
4-[1-prop-2-enyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol (CAS 669764-18-5) is a chemical compound with the molecular formula C17H13F3N2O2 and a molecular weight of 334.29 g/mol. IUPAC name: 4-[1-prop-2-enyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol. InChIKey: ZDUDMCQPFKPISO-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N2O2 |
|---|---|
| Molecular weight | 334.29 g/mol |
| IUPAC name | 4-[1-prop-2-enyl-7-(trifluoromethyl)indazol-3-yl]benzene-1,3-diol |
| InChIKey | ZDUDMCQPFKPISO-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=C(C=CC=C2C(F)(F)F)C(=N1)C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)