CAS 850692-43-2 appears in our catalog under these names: WAY-260022/ 99.06% (existing batch purity), ZNDZJNVJUAKEQC-JTDSTZFVSA-N, WAY-260022. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 10 mg.
1-[(1S)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol (CAS 850692-43-2) is a chemical compound with the molecular formula C21H31F3N2O2 and a molecular weight of 400.5 g/mol. IUPAC name: 1-[(1S)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol. InChIKey: ZNDZJNVJUAKEQC-JTDSTZFVSA-N.
| Molecular formula | C21H31F3N2O2 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 1-[(1S)-2-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
| InChIKey | ZNDZJNVJUAKEQC-JTDSTZFVSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C[C@H](C2=CC(=CC=C2)OC(F)(F)F)C3(CCCCC3)O |
Computed by PubChem (NCBI)