CAS 303134-93-2 appears in our catalog under these names: 2-(2-((2-(2-Fluorophenoxy)ethyl)thio)-1H-benzo[d]imidazol-1-yl)acetic acid, 96%, 96%, WAY-298630/ 97.13% (existing batch purity), PDK1 allosteric modulator 1, 99.34%. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 500mg, 10 mg.
2-[2-[2-(2-fluorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetic acid (CAS 303134-93-2) is a chemical compound with the molecular formula C17H15FN2O3S and a molecular weight of 346.4 g/mol. IUPAC name: 2-[2-[2-(2-fluorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetic acid. InChIKey: ZNRFTUGFUAAFSR-UHFFFAOYSA-N.
| Molecular formula | C17H15FN2O3S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-[2-[2-(2-fluorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetic acid |
| InChIKey | ZNRFTUGFUAAFSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CC(=O)O)SCCOC3=CC=CC=C3F |
Computed by PubChem (NCBI)