CAS 851185-20-1 appears in our catalog under these names: WAY-640509/ 98.59% (existing batch purity), Glucocerebrosidase-IN-2, WAY-640509, 98%, 98%. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-pyridin-3-ylquinazoline (CAS 851185-20-1) is a chemical compound with the molecular formula C25H23N5O4S and a molecular weight of 489.5 g/mol. IUPAC name: 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-pyridin-3-ylquinazoline. InChIKey: HXGUZRYTCIJSCT-UHFFFAOYSA-N.
| Molecular formula | C25H23N5O4S |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | 4-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-2-pyridin-3-ylquinazoline |
| InChIKey | HXGUZRYTCIJSCT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC(=NC3=CC=CC=C32)C4=CN=CC=C4)S(=O)(=O)C5=CC6=C(C=C5)OCCO6 |
Computed by PubChem (NCBI)