cas: 1804915-68-1 — see every product listed under this CAS number, including other names
WCK-4234 (CAS 1804915-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134OKJ-1mg |
| cas | 1804915-68-1 |
| size | 1mg |
| availability | 0.2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 376.40 Pln | |
| Chemat | 2mg | 520.40 Pln | |
| Chemat | 5mg | 818.00 Pln | |
| Chemat | 10mg | 1178.00 Pln | |
| Chemat | 25mg | 1960.40 Pln | |
| Chemat | 50mg | 2776.40 Pln | |
| Chemat | 100mg | 3726.80 Pln | |
| Chemat | 200mg | 5008.40 Pln |
| delivery time | 3 weeks |
|---|
Sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 1804915-68-1) is a chemical compound with the molecular formula C7H8N3NaO5S and a molecular weight of 269.21 g/mol. IUPAC name: sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: RYJWKSOILDDAHI-RIHPBJNCSA-M.
| Molecular formula | C7H8N3NaO5S |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | RYJWKSOILDDAHI-RIHPBJNCSA-M |
| SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C#N.[Na+] |
Computed by PubChem (NCBI)