CAS 1804915-68-1 appears in our catalog under these names: WCK–4234, Avibactam Impurity 67 Sodium Salt, WCK-4234 sodium/ 99.55% (existing batch purity), WCK-4234, WCK-4234, 98.0%. Offered by: GLPBio, Chemat Brand, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, on request, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
Sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CAS 1804915-68-1) is a chemical compound with the molecular formula C7H8N3NaO5S and a molecular weight of 269.21 g/mol. IUPAC name: sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate. InChIKey: RYJWKSOILDDAHI-RIHPBJNCSA-M.
| Molecular formula | C7H8N3NaO5S |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | sodium [(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| InChIKey | RYJWKSOILDDAHI-RIHPBJNCSA-M |
| SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C#N.[Na+] |
Computed by PubChem (NCBI)