CAS 211555-04-3 appears in our catalog under these names: WHI-P154/ 99.19% (existing batch purity), WHI–P154, WHI-P 154, WHI-P154, >98.0%(HPLC), WHI-P154 98%. Offered by: TargetMol, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 250mg.
2-bromo-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol (CAS 211555-04-3) is a chemical compound with the molecular formula C16H14BrN3O3 and a molecular weight of 376.20 g/mol. IUPAC name: 2-bromo-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol. InChIKey: CBIAKDAYHRWZCU-UHFFFAOYSA-N.
| Molecular formula | C16H14BrN3O3 |
|---|---|
| Molecular weight | 376.20 g/mol |
| IUPAC name | 2-bromo-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| InChIKey | CBIAKDAYHRWZCU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)O)Br)OC |
Computed by PubChem (NCBI)