CAS 3009908-95-3 appears in our catalog under these names: WJ-39/ 99.45% (existing batch purity), WJ–39, 2-(3-(2,3-Dichlorobenzyl)-6-methoxy-4-oxoquinolin-1(4H)-yl)acetic acid, potassium salt, 98%, 98%, WJ-39, 99.60%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10mM/1mL.
Potassium 2-[3-[(2,3-dichlorophenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetate (CAS 3009908-95-3) is a chemical compound with the molecular formula C19H14Cl2KNO4 and a molecular weight of 430.3 g/mol. IUPAC name: potassium 2-[3-[(2,3-dichlorophenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetate. InChIKey: KOVHOMQLMHEHRB-UHFFFAOYSA-M.
| Molecular formula | C19H14Cl2KNO4 |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | potassium 2-[3-[(2,3-dichlorophenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetate |
| InChIKey | KOVHOMQLMHEHRB-UHFFFAOYSA-M |
| SMILES | COC1=CC2=C(C=C1)N(C=C(C2=O)CC3=C(C(=CC=C3)Cl)Cl)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)