CAS 2229025-70-9 appears in our catalog under these names: WM–3835, WM-3835/ 97.47% (existing batch purity), WM-3835, WM-3835 98%, WM-3835, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1g.
2-fluoro-N'-(3-hydroxyphenyl)sulfonyl-3-methyl-5-phenylbenzohydrazide (CAS 2229025-70-9) is a chemical compound with the molecular formula C20H17FN2O4S and a molecular weight of 400.4 g/mol. IUPAC name: 2-fluoro-N'-(3-hydroxyphenyl)sulfonyl-3-methyl-5-phenylbenzohydrazide. InChIKey: KVJFJJXCBRSCDY-UHFFFAOYSA-N.
| Molecular formula | C20H17FN2O4S |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 2-fluoro-N'-(3-hydroxyphenyl)sulfonyl-3-methyl-5-phenylbenzohydrazide |
| InChIKey | KVJFJJXCBRSCDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NNS(=O)(=O)C2=CC=CC(=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)