CAS 1421227-52-2 appears in our catalog under these names: WS3, WS 3, WS3/ 98.77% (existing batch purity), WS3, 98%, 98%, WS3, 98.70%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 500mg, 10mg, 100mg, 1g, 200mg, 10mM (in 1ml dmso), 50mg, 5mg.
N-[6-[4-[[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]cyclopropanecarboxamide (CAS 1421227-52-2) is a chemical compound with the molecular formula C28H30F3N7O3 and a molecular weight of 569.6 g/mol. IUPAC name: N-[6-[4-[[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]cyclopropanecarboxamide. InChIKey: KIKOYRNAERIVSJ-UHFFFAOYSA-N.
| Molecular formula | C28H30F3N7O3 |
|---|---|
| Molecular weight | 569.6 g/mol |
| IUPAC name | N-[6-[4-[[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyrimidin-4-yl]cyclopropanecarboxamide |
| InChIKey | KIKOYRNAERIVSJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC4=NC=NC(=C4)NC(=O)C5CC5)C(F)(F)F |
Computed by PubChem (NCBI)