CAS 1352750-34-5 appears in our catalog under these names: WSP–1, WSP-1/ 98.01% (existing batch purity), WSP1, WSP-1 97%, 3'-Methoxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthen]-6'-yl 2-(pyridin-2-yldisulfaneyl)benzoate, 97%, 97%. Offered by: GLPBio, TargetMol, Chemat, Ambeed, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 250mg.
(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-(pyridin-2-yldisulfanyl)benzoate (CAS 1352750-34-5) is a chemical compound with the molecular formula C33H21NO6S2 and a molecular weight of 591.7 g/mol. IUPAC name: (6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-(pyridin-2-yldisulfanyl)benzoate. InChIKey: VHKQAUGSGQUCDU-UHFFFAOYSA-N.
| Molecular formula | C33H21NO6S2 |
|---|---|
| Molecular weight | 591.7 g/mol |
| IUPAC name | (6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-(pyridin-2-yldisulfanyl)benzoate |
| InChIKey | VHKQAUGSGQUCDU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C5=CC=CC=C5SSC6=CC=CC=N6)C7=CC=CC=C7C(=O)O3 |
Computed by PubChem (NCBI)